About butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate
butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate (PubChem CID 87417808) has the molecular formula C8H11FN2O2S
and a molecular weight of 218.25 g/mol. Its IUPAC name is butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate.
Molecular Properties
| Compound Name | butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate |
| PubChem CID | 87417808 |
| Molecular Formula | C8H11FN2O2S |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate |
| SMILES | CCCCOC(=O)Nc1ncc(F)s1 |
| InChI | InChI=1S/C8H11FN2O2S/c1-2-3-4-13-8(12)11-7-10-5-6(9)14-7/h5H,2-4H2,1H3,(H,10,11,12) |
| InChIKey | OOFNSFNXQBASPC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate?
The IUPAC name of butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate (CID 87417808) is butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate.
What is the SMILES notation for butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate?
The canonical SMILES for butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate is CCCCOC(=O)Nc1ncc(F)s1.
What is the InChIKey of butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate?
The InChIKey is OOFNSFNXQBASPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11FN2O2S/c1-2-3-4-13-8(12)11-7-10-5-6(9)14-7/h5H,2-4H2,1H3,(H,10,11,12).
What are the key properties of butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate?
butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate has a molecular weight of 218.25 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl N-(5-fluoro-1,3-thiazol-2-yl)carbamate is sourced from PubChem (CID 87417808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).