C24H27F6N3O2 — CID 87418079
N,N-diethyl-4-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid (PubChem CID 87418079) has the molecular formula C24H27F6N3O2 and a molecular weight of 503.49 g/mol. Its IUPAC name is N,N-diethyl-4-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-diethyl-4-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87418079 |
| Molecular Formula | C24H27F6N3O2 |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N,N-diethyl-4-[3-phenyl-6-(trifluoromethyl)benzimidazol-4-yl]butan-1-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCN(CC)CCCCc1cc(C(F)(F)F)cc2ncn(-c3ccccc3)c12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26F3N3.C2HF3O2/c1-3-27(4-2)13-9-8-10-17-14-18(22(23,24)25)15-20-21(17)28(16-26-20)19-11-6-5-7-12-19;3-2(4,5)1(6)7/h5-7,11-12,14-16H,3-4,8-10,13H2,1-2H3;(H,6,7) |
| InChIKey | CDCPBLGXCFSQOJ-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|