About (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid (PubChem CID 87418219) has the molecular formula C12H18O8S
and a molecular weight of 322.34 g/mol. Its IUPAC name is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid.
Molecular Properties
| Compound Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid |
| PubChem CID | 87418219 |
| Molecular Formula | C12H18O8S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H16O4S.C2H2O4/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;3-1(4)2(5)6/h7H,3-6H2,1-2H3,(H,12,13,14);(H,3,4)(H,5,6) |
| InChIKey | NZXRFKGVSKRNIZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid?
The IUPAC name of (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid (CID 87418219) is (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid.
What is the SMILES notation for (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid?
The canonical SMILES for (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid is CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2.O=C(O)C(=O)O.
What is the InChIKey of (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid?
The InChIKey is NZXRFKGVSKRNIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4S.C2H2O4/c1-9(2)7-3-4-10(9,8(11)5-7)6-15(12,13)14;3-1(4)2(5)6/h7H,3-6H2,1-2H3,(H,12,13,14);(H,3,4)(H,5,6).
What are the key properties of (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid?
(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid has a molecular weight of 322.34 g/mol, XLogP of 0.43, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methanesulfonic acid;oxalic acid is sourced from PubChem (CID 87418219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).