C29H22BF10N3O2 — CID 87418475
3-(3,5-difluoro-2-pyridinyl)-5-[4-fluoro-3-(trifluoromethyl)phenyl]pyridazine;2-[4-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 87418475) has the molecular formula C29H22BF10N3O2 and a molecular weight of 645.31 g/mol. Its IUPAC name is 3-(3,5-difluoro-2-pyridinyl)-5-[4-fluoro-3-(trifluoromethyl)phenyl]pyridazine;2-[4-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 3-(3,5-difluoro-2-pyridinyl)-5-[4-fluoro-3-(trifluoromethyl)phenyl]pyridazine;2-[4-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 87418475 |
| Molecular Formula | C29H22BF10N3O2 |
| Molecular Weight | 645.31 g/mol |
| Exact Mass | 645.16 |
| IUPAC Name | 3-(3,5-difluoro-2-pyridinyl)-5-[4-fluoro-3-(trifluoromethyl)phenyl]pyridazine;2-[4-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(F)c(C(F)(F)F)c2)OC1(C)C.Fc1cnc(-c2cc(-c3ccc(F)c(C(F)(F)F)c3)cnn2)c(F)c1 |
| InChI | InChI=1S/C16H7F6N3.C13H15BF4O2/c17-10-5-13(19)15(23-7-10)14-4-9(6-24-25-14)8-1-2-12(18)11(3-8)16(20,21)22;1-11(2)12(3,4)20-14(19-11)8-5-6-10(15)9(7-8)13(16,17)18/h1-7H;5-7H,1-4H3 |
| InChIKey | JTIJXJAEJLJJSV-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.31 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|