C26H22F6O5S — CID 87418752
3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]benzaldehyde;(4-formyl-2,6-dimethylphenyl) trifluoromethanesulfonate (PubChem CID 87418752) has the molecular formula C26H22F6O5S and a molecular weight of 560.51 g/mol. Its IUPAC name is 3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]benzaldehyde;(4-formyl-2,6-dimethylphenyl) trifluoromethanesulfonate.
| Compound Name | 3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]benzaldehyde;(4-formyl-2,6-dimethylphenyl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87418752 |
| Molecular Formula | C26H22F6O5S |
| Molecular Weight | 560.51 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 3,5-dimethyl-4-[4-(trifluoromethyl)phenyl]benzaldehyde;(4-formyl-2,6-dimethylphenyl) trifluoromethanesulfonate |
| SMILES | Cc1cc(C=O)cc(C)c1-c1ccc(C(F)(F)F)cc1.Cc1cc(C=O)cc(C)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H13F3O.C10H9F3O4S/c1-10-7-12(9-20)8-11(2)15(10)13-3-5-14(6-4-13)16(17,18)19;1-6-3-8(5-14)4-7(2)9(6)17-18(15,16)10(11,12)13/h3-9H,1-2H3;3-5H,1-2H3 |
| InChIKey | VCNJBLQZJQTQOD-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.51 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|