C17H16F3NO — CID 874192
N-(3,3-diphenylpropyl)-2,2,2-trifluoroacetamide (PubChem CID 874192) has the molecular formula C17H16F3NO and a molecular weight of 307.32 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(3,3-diphenylpropyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 874192 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NCCC(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H16F3NO/c18-17(19,20)16(22)21-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2,(H,21,22) |
| InChIKey | WIYQUGLQLHRYPZ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |