About 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol
4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol (PubChem CID 87419761) has the molecular formula C6H11NS2
and a molecular weight of 161.29 g/mol. Its IUPAC name is 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol.
Molecular Properties
| Compound Name | 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol |
| PubChem CID | 87419761 |
| Molecular Formula | C6H11NS2 |
| Molecular Weight | 161.29 g/mol |
| Exact Mass | 161.03 |
| IUPAC Name | 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol |
| SMILES | CNC1=C(S)CSCC1 |
| InChI | InChI=1S/C6H11NS2/c1-7-5-2-3-9-4-6(5)8/h7-8H,2-4H2,1H3 |
| InChIKey | GUQHULGEWHRQJA-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.29 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol?
The IUPAC name of 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol (CID 87419761) is 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol.
What is the SMILES notation for 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol?
The canonical SMILES for 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol is CNC1=C(S)CSCC1.
What is the InChIKey of 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol?
The InChIKey is GUQHULGEWHRQJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NS2/c1-7-5-2-3-9-4-6(5)8/h7-8H,2-4H2,1H3.
What are the key properties of 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol?
4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol has a molecular weight of 161.29 g/mol, XLogP of 1.48, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)-3,6-dihydro-2H-thiopyran-5-thiol is sourced from PubChem (CID 87419761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).