About 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide
2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide (PubChem CID 87419830) has the molecular formula C15H19N3O2S2
and a molecular weight of 337.47 g/mol. Its IUPAC name is 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide.
Molecular Properties
| Compound Name | 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide |
| PubChem CID | 87419830 |
| Molecular Formula | C15H19N3O2S2 |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide |
| SMILES | CCCCCOc1cc(C(=S)Nc2nccs2)cc(OC)n1 |
| InChI | InChI=1S/C15H19N3O2S2/c1-3-4-5-7-20-13-10-11(9-12(17-13)19-2)14(21)18-15-16-6-8-22-15/h6,8-10H,3-5,7H2,1-2H3,(H,16,18,21) |
| InChIKey | WNBQHZYIEAWXFC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide?
The IUPAC name of 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide (CID 87419830) is 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide.
What is the SMILES notation for 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide?
The canonical SMILES for 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide is CCCCCOc1cc(C(=S)Nc2nccs2)cc(OC)n1.
What is the InChIKey of 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide?
The InChIKey is WNBQHZYIEAWXFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O2S2/c1-3-4-5-7-20-13-10-11(9-12(17-13)19-2)14(21)18-15-16-6-8-22-15/h6,8-10H,3-5,7H2,1-2H3,(H,16,18,21).
What are the key properties of 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide?
2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide has a molecular weight of 337.47 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-pentoxy-N-(1,3-thiazol-2-yl)pyridine-4-carbothioamide is sourced from PubChem (CID 87419830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).