C18H19FN4O4S2 — CID 87420182
1-[1-[(5-fluoro-1,3-thiazol-2-yl)amino]-3-(oxan-4-yl)-1-oxopropan-2-yl]indazole-4-sulfinic acid (PubChem CID 87420182) has the molecular formula C18H19FN4O4S2 and a molecular weight of 438.51 g/mol. Its IUPAC name is 1-[1-[(5-fluoro-1,3-thiazol-2-yl)amino]-3-(oxan-4-yl)-1-oxopropan-2-yl]indazole-4-sulfinic acid.
| Compound Name | 1-[1-[(5-fluoro-1,3-thiazol-2-yl)amino]-3-(oxan-4-yl)-1-oxopropan-2-yl]indazole-4-sulfinic acid |
|---|---|
| PubChem CID | 87420182 |
| Molecular Formula | C18H19FN4O4S2 |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 1-[1-[(5-fluoro-1,3-thiazol-2-yl)amino]-3-(oxan-4-yl)-1-oxopropan-2-yl]indazole-4-sulfinic acid |
| SMILES | O=C(Nc1ncc(F)s1)C(CC1CCOCC1)n1ncc2c(S(=O)O)cccc21 |
| InChI | InChI=1S/C18H19FN4O4S2/c19-16-10-20-18(28-16)22-17(24)14(8-11-4-6-27-7-5-11)23-13-2-1-3-15(29(25)26)12(13)9-21-23/h1-3,9-11,14H,4-8H2,(H,25,26)(H,20,22,24) |
| InChIKey | ARWCQUSRHKUONC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|