C11H22N2 — CID 87420332
2-N,2-N,2-trimethyl-1-N-[(1Z)-3-methylbuta-1,3-dienyl]propane-1,2-diamine (PubChem CID 87420332) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-N,2-N,2-trimethyl-1-N-[(1Z)-3-methylbuta-1,3-dienyl]propane-1,2-diamine.
| Compound Name | 2-N,2-N,2-trimethyl-1-N-[(1Z)-3-methylbuta-1,3-dienyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 87420332 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-N,2-N,2-trimethyl-1-N-[(1Z)-3-methylbuta-1,3-dienyl]propane-1,2-diamine |
| SMILES | C=C(C)/C=C\NCC(C)(C)N(C)C |
| InChI | InChI=1S/C11H22N2/c1-10(2)7-8-12-9-11(3,4)13(5)6/h7-8,12H,1,9H2,2-6H3/b8-7- |
| InChIKey | NKSPLURTMOPWRO-FPLPWBNLSA-N |
| XLogP | 2.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|