About N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine
N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine (PubChem CID 87420335) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine |
| PubChem CID | 87420335 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine |
| SMILES | C=C(C)/C=C\NCCN |
| InChI | InChI=1S/C7H14N2/c1-7(2)3-5-9-6-4-8/h3,5,9H,1,4,6,8H2,2H3/b5-3- |
| InChIKey | IZOQTMMOENMHFF-HYXAFXHYSA-N |
| XLogP | 0.62 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine?
The IUPAC name of N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine (CID 87420335) is N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine?
The canonical SMILES for N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine is C=C(C)/C=C\NCCN.
What is the InChIKey of N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine?
The InChIKey is IZOQTMMOENMHFF-HYXAFXHYSA-N. The full InChI is InChI=1S/C7H14N2/c1-7(2)3-5-9-6-4-8/h3,5,9H,1,4,6,8H2,2H3/b5-3-.
What are the key properties of N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine?
N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine has a molecular weight of 126.20 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine is sourced from PubChem (CID 87420335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).