C9H18N2 — CID 87420336
N',N'-dimethyl-N-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine (PubChem CID 87420336) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 87420336 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | N',N'-dimethyl-N-[(1Z)-3-methylbuta-1,3-dienyl]ethane-1,2-diamine |
| SMILES | C=C(C)/C=C\NCCN(C)C |
| InChI | InChI=1S/C9H18N2/c1-9(2)5-6-10-7-8-11(3)4/h5-6,10H,1,7-8H2,2-4H3/b6-5- |
| InChIKey | CIHGMSLCFMCCGC-WAYWQWQTSA-N |
| XLogP | 1.23 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|