C15H26O9 — CID 87420635
(3R,4S,5R,6S)-4-acetyl-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-5,6-dimethylnonane-2,8-dione (PubChem CID 87420635) has the molecular formula C15H26O9 and a molecular weight of 350.36 g/mol. Its IUPAC name is (3R,4S,5R,6S)-4-acetyl-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-5,6-dimethylnonane-2,8-dione.
| Compound Name | (3R,4S,5R,6S)-4-acetyl-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-5,6-dimethylnonane-2,8-dione |
|---|---|
| PubChem CID | 87420635 |
| Molecular Formula | C15H26O9 |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (3R,4S,5R,6S)-4-acetyl-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-5,6-dimethylnonane-2,8-dione |
| SMILES | CC(=O)C(O)[C@](C)(O)[C@@](C)(O)[C@@](O)(C(C)=O)[C@@](O)(C(C)=O)C(C)O |
| InChI | InChI=1S/C15H26O9/c1-7(16)11(20)12(5,21)13(6,22)15(24,10(4)19)14(23,8(2)17)9(3)18/h8,11,17,20-24H,1-6H3/t8?,11?,12-,13+,14-,15-/m0/s1 |
| InChIKey | YWIOPJFBNBTWHB-ADOMMUCPSA-N |
| XLogP | -2.54 |
| TPSA | 172.59 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |