C14H26O8 — CID 87420656
(3R,4S,5R,6S)-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-4,5,6-trimethylnonane-2,8-dione (PubChem CID 87420656) has the molecular formula C14H26O8 and a molecular weight of 322.35 g/mol. Its IUPAC name is (3R,4S,5R,6S)-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-4,5,6-trimethylnonane-2,8-dione.
| Compound Name | (3R,4S,5R,6S)-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-4,5,6-trimethylnonane-2,8-dione |
|---|---|
| PubChem CID | 87420656 |
| Molecular Formula | C14H26O8 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (3R,4S,5R,6S)-3,4,5,6,7-pentahydroxy-3-(1-hydroxyethyl)-4,5,6-trimethylnonane-2,8-dione |
| SMILES | CC(=O)C(O)[C@](C)(O)[C@@](C)(O)[C@](C)(O)[C@@](O)(C(C)=O)C(C)O |
| InChI | InChI=1S/C14H26O8/c1-7(15)10(18)11(4,19)12(5,20)13(6,21)14(22,8(2)16)9(3)17/h8,10,16,18-22H,1-6H3/t8?,10?,11-,12+,13-,14-/m0/s1 |
| InChIKey | HTKQOBRPRZNVTL-OUYZFCJYSA-N |
| XLogP | -2.11 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | -2.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |