About 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide
2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide (PubChem CID 87421132) has the molecular formula C5H6N2O3S
and a molecular weight of 174.18 g/mol. Its IUPAC name is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide.
Molecular Properties
| Compound Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide |
| PubChem CID | 87421132 |
| Molecular Formula | C5H6N2O3S |
| Molecular Weight | 174.18 g/mol |
| Exact Mass | 174.01 |
| IUPAC Name | 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)CSC1=O |
| InChI | InChI=1S/C5H6N2O3S/c6-3(8)1-7-4(9)2-11-5(7)10/h1-2H2,(H2,6,8) |
| InChIKey | UXCKKOYSAUSIJU-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.18 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide?
The IUPAC name of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide (CID 87421132) is 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide.
What is the SMILES notation for 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide?
The canonical SMILES for 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide is NC(=O)CN1C(=O)CSC1=O.
What is the InChIKey of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide?
The InChIKey is UXCKKOYSAUSIJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3S/c6-3(8)1-7-4(9)2-11-5(7)10/h1-2H2,(H2,6,8).
What are the key properties of 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide?
2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide has a molecular weight of 174.18 g/mol, XLogP of -0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-dioxo-1,3-thiazolidin-3-yl)acetamide is sourced from PubChem (CID 87421132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).