C6H4F6N2 — CID 87421777
1-(1,1,2,3,3,3-hexafluoropropyl)pyrazole (PubChem CID 87421777) has the molecular formula C6H4F6N2 and a molecular weight of 218.10 g/mol. Its IUPAC name is 1-(1,1,2,3,3,3-hexafluoropropyl)pyrazole.
| Compound Name | 1-(1,1,2,3,3,3-hexafluoropropyl)pyrazole |
|---|---|
| PubChem CID | 87421777 |
| Molecular Formula | C6H4F6N2 |
| Molecular Weight | 218.10 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-(1,1,2,3,3,3-hexafluoropropyl)pyrazole |
| SMILES | FC(C(F)(F)F)C(F)(F)n1cccn1 |
| InChI | InChI=1S/C6H4F6N2/c7-4(5(8,9)10)6(11,12)14-3-1-2-13-14/h1-4H |
| InChIKey | PAIAJIHRDDFVCE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.10 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |