C35H50FN7O4Si2 — CID 87421838
2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-pyrimidin-2-yl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid (PubChem CID 87421838) has the molecular formula C35H50FN7O4Si2 and a molecular weight of 708.00 g/mol. Its IUPAC name is 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-pyrimidin-2-yl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid.
| Compound Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-pyrimidin-2-yl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 87421838 |
| Molecular Formula | C35H50FN7O4Si2 |
| Molecular Weight | 708.00 g/mol |
| Exact Mass | 707.34 |
| IUPAC Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-pyrimidin-2-yl-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC(C(F)C(=O)O)CC2)nc2c(-c3ccc(-c4ncccn4)nc3)cnn12 |
| InChI | InChI=1S/C35H50FN7O4Si2/c1-48(2,3)18-16-46-23-42(24-47-17-19-49(4,5)6)31-20-30(25-8-10-26(11-9-25)32(36)35(44)45)41-34-28(22-40-43(31)34)27-12-13-29(39-21-27)33-37-14-7-15-38-33/h7,12-15,20-22,25-26,32H,8-11,16-19,23-24H2,1-6H3,(H,44,45) |
| InChIKey | IXGQLSDVRLQBBT-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 127.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.00 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|