C31H47ClFN5O4Si2 — CID 87421851
2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid (PubChem CID 87421851) has the molecular formula C31H47ClFN5O4Si2 and a molecular weight of 664.37 g/mol. Its IUPAC name is 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid.
| Compound Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid |
|---|---|
| PubChem CID | 87421851 |
| Molecular Formula | C31H47ClFN5O4Si2 |
| Molecular Weight | 664.37 g/mol |
| Exact Mass | 663.28 |
| IUPAC Name | 2-[4-[7-[bis(2-trimethylsilylethoxymethyl)amino]-3-(6-chloro-3-pyridinyl)pyrazolo[1,5-a]pyrimidin-5-yl]cyclohexyl]-2-fluoroacetic acid |
| SMILES | C[Si](C)(C)CCOCN(COCC[Si](C)(C)C)c1cc(C2CCC(C(F)C(=O)O)CC2)nc2c(-c3ccc(Cl)nc3)cnn12 |
| InChI | InChI=1S/C31H47ClFN5O4Si2/c1-43(2,3)15-13-41-20-37(21-42-14-16-44(4,5)6)28-17-26(22-7-9-23(10-8-22)29(33)31(39)40)36-30-25(19-35-38(28)30)24-11-12-27(32)34-18-24/h11-12,17-19,22-23,29H,7-10,13-16,20-21H2,1-6H3,(H,39,40) |
| InChIKey | OIMYRFCHWZAPLC-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 102.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.37 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|