C21H28BrN3O3S — CID 87422124
(1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[4-(hydroxymethyl)cyclohexyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 87422124) has the molecular formula C21H28BrN3O3S and a molecular weight of 482.44 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[4-(hydroxymethyl)cyclohexyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[4-(hydroxymethyl)cyclohexyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 87422124 |
| Molecular Formula | C21H28BrN3O3S |
| Molecular Weight | 482.44 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[4-(hydroxymethyl)cyclohexyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | O=C(NC1CCC(CO)CC1)[C@H]1[C@H](C(=O)Nc2ncc(Br)s2)[C@@H]2CC[C@H]1C21CC1 |
| InChI | InChI=1S/C21H28BrN3O3S/c22-15-9-23-20(29-15)25-19(28)17-14-6-5-13(21(14)7-8-21)16(17)18(27)24-12-3-1-11(10-26)2-4-12/h9,11-14,16-17,26H,1-8,10H2,(H,24,27)(H,23,25,28)/t11?,12?,13-,14+,16-,17-/m1/s1 |
| InChIKey | LOMUBZUTIQZRBB-RQKYGCCFSA-N |
| XLogP | 3.56 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.44 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |