C18H24BrN3O4S — CID 87422340
(1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[2-(2-hydroxyethoxy)ethyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide (PubChem CID 87422340) has the molecular formula C18H24BrN3O4S and a molecular weight of 458.38 g/mol. Its IUPAC name is (1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[2-(2-hydroxyethoxy)ethyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide.
| Compound Name | (1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[2-(2-hydroxyethoxy)ethyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
|---|---|
| PubChem CID | 87422340 |
| Molecular Formula | C18H24BrN3O4S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | (1R,2R,3R,4S)-3-N-(5-bromo-1,3-thiazol-2-yl)-2-N-[2-(2-hydroxyethoxy)ethyl]spiro[bicyclo[2.2.1]heptane-7,1'-cyclopropane]-2,3-dicarboxamide |
| SMILES | O=C(NCCOCCO)[C@H]1[C@H](C(=O)Nc2ncc(Br)s2)[C@@H]2CC[C@H]1C21CC1 |
| InChI | InChI=1S/C18H24BrN3O4S/c19-12-9-21-17(27-12)22-16(25)14-11-2-1-10(18(11)3-4-18)13(14)15(24)20-5-7-26-8-6-23/h9-11,13-14,23H,1-8H2,(H,20,24)(H,21,22,25)/t10-,11+,13-,14-/m1/s1 |
| InChIKey | LAODHUZQKOBJIN-ZMJPVWNMSA-N |
| XLogP | 2.02 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|