C8H12F2N2 — CID 87422780
(1E,3Z,6E)-1,6-difluoro-4-methylhepta-1,3,6-triene-1,7-diamine (PubChem CID 87422780) has the molecular formula C8H12F2N2 and a molecular weight of 174.19 g/mol. Its IUPAC name is (1E,3Z,6E)-1,6-difluoro-4-methylhepta-1,3,6-triene-1,7-diamine.
| Compound Name | (1E,3Z,6E)-1,6-difluoro-4-methylhepta-1,3,6-triene-1,7-diamine |
|---|---|
| PubChem CID | 87422780 |
| Molecular Formula | C8H12F2N2 |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (1E,3Z,6E)-1,6-difluoro-4-methylhepta-1,3,6-triene-1,7-diamine |
| SMILES | C/C(=C/C=C(\N)F)C/C(F)=C\N |
| InChI | InChI=1S/C8H12F2N2/c1-6(2-3-8(10)12)4-7(9)5-11/h2-3,5H,4,11-12H2,1H3/b6-2-,7-5+,8-3- |
| InChIKey | OEXRIACDZRVPCN-LDVPIRJWSA-N |
| XLogP | 1.86 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|