C10H6F12 — CID 87422931
3,3,4,4,5,5,6-heptafluoro-6-(1,1,2,2,2-pentafluoroethyl)octa-1,7-diene (PubChem CID 87422931) has the molecular formula C10H6F12 and a molecular weight of 354.13 g/mol. Its IUPAC name is 3,3,4,4,5,5,6-heptafluoro-6-(1,1,2,2,2-pentafluoroethyl)octa-1,7-diene.
| Compound Name | 3,3,4,4,5,5,6-heptafluoro-6-(1,1,2,2,2-pentafluoroethyl)octa-1,7-diene |
|---|---|
| PubChem CID | 87422931 |
| Molecular Formula | C10H6F12 |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 3,3,4,4,5,5,6-heptafluoro-6-(1,1,2,2,2-pentafluoroethyl)octa-1,7-diene |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(C=C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H6F12/c1-3-5(11,8(16,17)10(20,21)22)7(14,15)9(18,19)6(12,13)4-2/h3-4H,1-2H2 |
| InChIKey | NCFDKEKVJZDNPJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|