C7H4F13N — CID 87423237
1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoroheptan-1-amine (PubChem CID 87423237) has the molecular formula C7H4F13N and a molecular weight of 349.09 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoroheptan-1-amine.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoroheptan-1-amine |
|---|---|
| PubChem CID | 87423237 |
| Molecular Formula | C7H4F13N |
| Molecular Weight | 349.09 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluoroheptan-1-amine |
| SMILES | NC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C7H4F13N/c8-1-2(9,10)3(11,12)4(13,14)5(15,16)6(17,18)7(19,20)21/h1,21H2 |
| InChIKey | RBYRKWXWCLSSRP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.09 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|