C34H37F3N6O9S2 — CID 87423925
[4-[2-carbamoyl-5-[4-quinolin-3-yl-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid (PubChem CID 87423925) has the molecular formula C34H37F3N6O9S2 and a molecular weight of 794.83 g/mol. Its IUPAC name is [4-[2-carbamoyl-5-[4-quinolin-3-yl-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid.
| Compound Name | [4-[2-carbamoyl-5-[4-quinolin-3-yl-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid |
|---|---|
| PubChem CID | 87423925 |
| Molecular Formula | C34H37F3N6O9S2 |
| Molecular Weight | 794.83 g/mol |
| Exact Mass | 794.20 |
| IUPAC Name | [4-[2-carbamoyl-5-[4-quinolin-3-yl-3-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]anilino]cyclohexyl] 2-aminoacetate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.NCC(=O)OC1CCC(Nc2cc(-n3cc(C(F)(F)F)c4c(-c5cnc6ccccc6c5)ccnc43)ccc2C(N)=O)CC1 |
| InChI | InChI=1S/C32H29F3N6O3.2CH4O3S/c33-32(34,35)25-17-41(31-29(25)23(11-12-38-31)19-13-18-3-1-2-4-26(18)39-16-19)21-7-10-24(30(37)43)27(14-21)40-20-5-8-22(9-6-20)44-28(42)15-36;2*1-5(2,3)4/h1-4,7,10-14,16-17,20,22,40H,5-6,8-9,15,36H2,(H2,37,43);2*1H3,(H,2,3,4) |
| InChIKey | JZBCNRWVKJCDDY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 246.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|