C28H29N7O — CID 87424144
6-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-4-(1H-indol-4-ylmethylamino)pyridine-3-carboxamide (PubChem CID 87424144) has the molecular formula C28H29N7O and a molecular weight of 479.59 g/mol. Its IUPAC name is 6-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-4-(1H-indol-4-ylmethylamino)pyridine-3-carboxamide.
| Compound Name | 6-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-4-(1H-indol-4-ylmethylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 87424144 |
| Molecular Formula | C28H29N7O |
| Molecular Weight | 479.59 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 6-[4-[1-(cyanomethyl)piperidin-4-yl]anilino]-4-(1H-indol-4-ylmethylamino)pyridine-3-carboxamide |
| SMILES | N#CCN1CCC(c2ccc(Nc3cc(NCc4cccc5[nH]ccc45)c(C(N)=O)cn3)cc2)CC1 |
| InChI | InChI=1S/C28H29N7O/c29-11-15-35-13-9-20(10-14-35)19-4-6-22(7-5-19)34-27-16-26(24(18-33-27)28(30)36)32-17-21-2-1-3-25-23(21)8-12-31-25/h1-8,12,16,18,20,31H,9-10,13-15,17H2,(H2,30,36)(H2,32,33,34) |
| InChIKey | WIFRFUPGPZULTK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 122.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.59 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|