About (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate
(benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate (PubChem CID 87424175) has the molecular formula C26H29N3O
and a molecular weight of 399.54 g/mol. Its IUPAC name is (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate.
Molecular Properties
| Compound Name | (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate |
| PubChem CID | 87424175 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C(\N)ON=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H29N3O/c1-18(2)22-16-11-17-23(19(3)4)25(22)28-26(27)30-29-24(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3,(H2,27,28) |
| InChIKey | FYBLCFJRMGMEBA-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate?
The IUPAC name of (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate (CID 87424175) is (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate.
What is the SMILES notation for (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate?
The canonical SMILES for (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate is CC(C)c1cccc(C(C)C)c1/N=C(\N)ON=C(c1ccccc1)c1ccccc1.
What is the InChIKey of (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate?
The InChIKey is FYBLCFJRMGMEBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H29N3O/c1-18(2)22-16-11-17-23(19(3)4)25(22)28-26(27)30-29-24(20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-19H,1-4H3,(H2,27,28).
What are the key properties of (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate?
(benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate has a molecular weight of 399.54 g/mol, XLogP of 6.35, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (benzhydrylideneamino) N'-[2,6-di(propan-2-yl)phenyl]carbamimidate is sourced from PubChem (CID 87424175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).