C21H16F5NO3 — CID 87424407
2-[[5-[1,1,2,2-tetrafluoro-2-(2-fluorophenyl)ethyl]oxolan-2-yl]methyl]isoindole-1,3-dione (PubChem CID 87424407) has the molecular formula C21H16F5NO3 and a molecular weight of 425.35 g/mol. Its IUPAC name is 2-[[5-[1,1,2,2-tetrafluoro-2-(2-fluorophenyl)ethyl]oxolan-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[1,1,2,2-tetrafluoro-2-(2-fluorophenyl)ethyl]oxolan-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 87424407 |
| Molecular Formula | C21H16F5NO3 |
| Molecular Weight | 425.35 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | 2-[[5-[1,1,2,2-tetrafluoro-2-(2-fluorophenyl)ethyl]oxolan-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC1CCC(C(F)(F)C(F)(F)c2ccccc2F)O1 |
| InChI | InChI=1S/C21H16F5NO3/c22-16-8-4-3-7-15(16)20(23,24)21(25,26)17-10-9-12(30-17)11-27-18(28)13-5-1-2-6-14(13)19(27)29/h1-8,12,17H,9-11H2 |
| InChIKey | TXITWUCRLRDIKZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|