C21H17Cl2F5N4O2 — CID 87424685
2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,3,3,3-pentafluoropropyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide (PubChem CID 87424685) has the molecular formula C21H17Cl2F5N4O2 and a molecular weight of 523.29 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,3,3,3-pentafluoropropyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide.
| Compound Name | 2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,3,3,3-pentafluoropropyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 87424685 |
| Molecular Formula | C21H17Cl2F5N4O2 |
| Molecular Weight | 523.29 g/mol |
| Exact Mass | 522.06 |
| IUPAC Name | 2-(2,6-dichloroanilino)-7,7-dimethyl-N-(2,2,3,3,3-pentafluoropropyl)-3,8-dihydrofuro[3,2-e]benzimidazole-5-carboxamide |
| SMILES | CC1(C)Cc2c(c(C(=O)NCC(F)(F)C(F)(F)F)cc3[nH]c(Nc4c(Cl)cccc4Cl)nc23)O1 |
| InChI | InChI=1S/C21H17Cl2F5N4O2/c1-19(2)7-10-14-13(30-18(31-14)32-15-11(22)4-3-5-12(15)23)6-9(16(10)34-19)17(33)29-8-20(24,25)21(26,27)28/h3-6H,7-8H2,1-2H3,(H,29,33)(H2,30,31,32) |
| InChIKey | NBINGOWAMJDHKN-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.29 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|