About 1-(disulfanyl)-3,5-difluorobenzene
1-(disulfanyl)-3,5-difluorobenzene (PubChem CID 87425076) has the molecular formula C6H4F2S2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 1-(disulfanyl)-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-(disulfanyl)-3,5-difluorobenzene |
| PubChem CID | 87425076 |
| Molecular Formula | C6H4F2S2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 177.97 |
| IUPAC Name | 1-(disulfanyl)-3,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(SS)c1 |
| InChI | InChI=1S/C6H4F2S2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,9H |
| InChIKey | WSIGPSGLCUDOEA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)-3,5-difluorobenzene?
The IUPAC name of 1-(disulfanyl)-3,5-difluorobenzene (CID 87425076) is 1-(disulfanyl)-3,5-difluorobenzene.
What is the SMILES notation for 1-(disulfanyl)-3,5-difluorobenzene?
The canonical SMILES for 1-(disulfanyl)-3,5-difluorobenzene is Fc1cc(F)cc(SS)c1.
What is the InChIKey of 1-(disulfanyl)-3,5-difluorobenzene?
The InChIKey is WSIGPSGLCUDOEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F2S2/c7-4-1-5(8)3-6(2-4)10-9/h1-3,9H.
What are the key properties of 1-(disulfanyl)-3,5-difluorobenzene?
1-(disulfanyl)-3,5-difluorobenzene has a molecular weight of 178.23 g/mol, XLogP of 2.90, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)-3,5-difluorobenzene is sourced from PubChem (CID 87425076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).