C22H38O4 — CID 87425494
2,5,8,10,13,15-hexamethylhexadeca-3,11-diyne-2,5,10,13-tetrol (PubChem CID 87425494) has the molecular formula C22H38O4 and a molecular weight of 366.54 g/mol. Its IUPAC name is 2,5,8,10,13,15-hexamethylhexadeca-3,11-diyne-2,5,10,13-tetrol.
| Compound Name | 2,5,8,10,13,15-hexamethylhexadeca-3,11-diyne-2,5,10,13-tetrol |
|---|---|
| PubChem CID | 87425494 |
| Molecular Formula | C22H38O4 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.28 |
| IUPAC Name | 2,5,8,10,13,15-hexamethylhexadeca-3,11-diyne-2,5,10,13-tetrol |
| SMILES | CC(C)CC(C)(O)C#CC(C)(O)CC(C)CCC(C)(O)C#CC(C)(C)O |
| InChI | InChI=1S/C22H38O4/c1-17(2)15-21(7,25)13-14-22(8,26)16-18(3)9-10-20(6,24)12-11-19(4,5)23/h17-18,23-26H,9-10,15-16H2,1-8H3 |
| InChIKey | JBFBTQJVMBKMSU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|