C26H9F9 — CID 87425635
2-fluoro-9,10-bis(2,3,5,6-tetrafluorophenyl)anthracene (PubChem CID 87425635) has the molecular formula C26H9F9 and a molecular weight of 492.34 g/mol. Its IUPAC name is 2-fluoro-9,10-bis(2,3,5,6-tetrafluorophenyl)anthracene.
| Compound Name | 2-fluoro-9,10-bis(2,3,5,6-tetrafluorophenyl)anthracene |
|---|---|
| PubChem CID | 87425635 |
| Molecular Formula | C26H9F9 |
| Molecular Weight | 492.34 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 2-fluoro-9,10-bis(2,3,5,6-tetrafluorophenyl)anthracene |
| SMILES | Fc1ccc2c(-c3c(F)c(F)cc(F)c3F)c3ccccc3c(-c3c(F)c(F)cc(F)c3F)c2c1 |
| InChI | InChI=1S/C26H9F9/c27-10-5-6-13-14(7-10)20(22-25(34)17(30)9-18(31)26(22)35)12-4-2-1-3-11(12)19(13)21-23(32)15(28)8-16(29)24(21)33/h1-9H |
| InChIKey | IPUXYDIRBQJTFR-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.34 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|