About 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene
9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene (PubChem CID 87425893) has the molecular formula C26H12F6
and a molecular weight of 438.37 g/mol. Its IUPAC name is 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene.
Molecular Properties
| Compound Name | 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene |
| PubChem CID | 87425893 |
| Molecular Formula | C26H12F6 |
| Molecular Weight | 438.37 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene |
| SMILES | Fc1ccc(-c2c3ccccc3c(-c3ccc(F)cc3F)c3cc(F)c(F)cc23)c(F)c1 |
| InChI | InChI=1S/C26H12F6/c27-13-5-7-17(21(29)9-13)25-15-3-1-2-4-16(15)26(18-8-6-14(28)10-22(18)30)20-12-24(32)23(31)11-19(20)25/h1-12H |
| InChIKey | CAQXPSKMJPMZJF-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.37 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene?
The IUPAC name of 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene (CID 87425893) is 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene.
What is the SMILES notation for 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene?
The canonical SMILES for 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene is Fc1ccc(-c2c3ccccc3c(-c3ccc(F)cc3F)c3cc(F)c(F)cc23)c(F)c1.
What is the InChIKey of 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene?
The InChIKey is CAQXPSKMJPMZJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H12F6/c27-13-5-7-17(21(29)9-13)25-15-3-1-2-4-16(15)26(18-8-6-14(28)10-22(18)30)20-12-24(32)23(31)11-19(20)25/h1-12H.
What are the key properties of 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene?
9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene has a molecular weight of 438.37 g/mol, XLogP of 8.16, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-bis(2,4-difluorophenyl)-2,3-difluoroanthracene is sourced from PubChem (CID 87425893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).