C20H15N — CID 87426054
12-azapentacyclo[11.8.0.01,6.06,11.016,21]henicosa-2,4,7,9,11,13,15,17,19-nonaene (PubChem CID 87426054) has the molecular formula C20H15N and a molecular weight of 269.35 g/mol. Its IUPAC name is 12-azapentacyclo[11.8.0.01,6.06,11.016,21]henicosa-2,4,7,9,11,13,15,17,19-nonaene.
| Compound Name | 12-azapentacyclo[11.8.0.01,6.06,11.016,21]henicosa-2,4,7,9,11,13,15,17,19-nonaene |
|---|---|
| PubChem CID | 87426054 |
| Molecular Formula | C20H15N |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 12-azapentacyclo[11.8.0.01,6.06,11.016,21]henicosa-2,4,7,9,11,13,15,17,19-nonaene |
| SMILES | C1=CC2=CC=C3N=C4C=CC=CC45C=CC=CC35C2C=C1 |
| InChI | InChI=1S/C20H15N/c1-2-8-16-15(7-1)10-11-18-20(16)14-6-5-13-19(20)12-4-3-9-17(19)21-18/h1-14,16H |
| InChIKey | APBIGBRZPWHDDC-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |