About (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide
(R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 87426486) has the molecular formula C14H20ClF2NO2S
and a molecular weight of 339.84 g/mol. Its IUPAC name is (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 87426486 |
| Molecular Formula | C14H20ClF2NO2S |
| Molecular Weight | 339.84 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(N[S@](=O)C(C)(C)C)c1ccc(OCC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C14H20ClF2NO2S/c1-9(18-21(19)14(2,3)4)10-5-6-12(11(15)7-10)20-8-13(16)17/h5-7,9,13,18H,8H2,1-4H3/t9?,21-/m1/s1 |
| InChIKey | ANBXSCSFKRLNSZ-SSKGYDFUSA-N |
| XLogP | 4.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.84 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide (CID 87426486) is (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide is CC(N[S@](=O)C(C)(C)C)c1ccc(OCC(F)F)c(Cl)c1.
What is the InChIKey of (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide?
The InChIKey is ANBXSCSFKRLNSZ-SSKGYDFUSA-N. The full InChI is InChI=1S/C14H20ClF2NO2S/c1-9(18-21(19)14(2,3)4)10-5-6-12(11(15)7-10)20-8-13(16)17/h5-7,9,13,18H,8H2,1-4H3/t9?,21-/m1/s1.
What are the key properties of (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide?
(R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide has a molecular weight of 339.84 g/mol, XLogP of 4.10, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-[1-[3-chloro-4-(2,2-difluoroethoxy)phenyl]ethyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 87426486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).