C15H19ClFNO4 — CID 87426506
(4R,5R)-4-(2-chloroethyl)-1-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-5-(fluoromethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 87426506) has the molecular formula C15H19ClFNO4 and a molecular weight of 331.77 g/mol. Its IUPAC name is (4R,5R)-4-(2-chloroethyl)-1-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-5-(fluoromethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (4R,5R)-4-(2-chloroethyl)-1-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-5-(fluoromethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 87426506 |
| Molecular Formula | C15H19ClFNO4 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (4R,5R)-4-(2-chloroethyl)-1-[(S)-cyclohex-2-en-1-yl(hydroxy)methyl]-5-(fluoromethyl)-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | O=C1NC2([C@@H](O)C3C=CCCC3)C(=O)O[C@]2(CF)[C@H]1CCCl |
| InChI | InChI=1S/C15H19ClFNO4/c16-7-6-10-12(20)18-15(13(21)22-14(10,15)8-17)11(19)9-4-2-1-3-5-9/h2,4,9-11,19H,1,3,5-8H2,(H,18,20)/t9?,10-,11-,14+,15?/m0/s1 |
| InChIKey | FOTYRZQSUYNVIK-OYZMQCDJSA-N |
| XLogP | 1.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|