About N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide
N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide (PubChem CID 87426573) has the molecular formula C16H25F2NO2S
and a molecular weight of 333.44 g/mol. Its IUPAC name is N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide |
| PubChem CID | 87426573 |
| Molecular Formula | C16H25F2NO2S |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide |
| SMILES | Cc1cc(C(C)NS(=O)C(C)(C)C)cc(C)c1OCC(F)F |
| InChI | InChI=1S/C16H25F2NO2S/c1-10-7-13(12(3)19-22(20)16(4,5)6)8-11(2)15(10)21-9-14(17)18/h7-8,12,14,19H,9H2,1-6H3 |
| InChIKey | XOEOQMWCXRPYSB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide?
The IUPAC name of N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide (CID 87426573) is N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide is Cc1cc(C(C)NS(=O)C(C)(C)C)cc(C)c1OCC(F)F.
What is the InChIKey of N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide?
The InChIKey is XOEOQMWCXRPYSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25F2NO2S/c1-10-7-13(12(3)19-22(20)16(4,5)6)8-11(2)15(10)21-9-14(17)18/h7-8,12,14,19H,9H2,1-6H3.
What are the key properties of N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide?
N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide has a molecular weight of 333.44 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[4-(2,2-difluoroethoxy)-3,5-dimethylphenyl]ethyl]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 87426573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).