C9H7F6N — CID 87427327
N,2,3,4,5,6-hexafluoro-N-propan-2-ylaniline (PubChem CID 87427327) has the molecular formula C9H7F6N and a molecular weight of 243.15 g/mol. Its IUPAC name is N,2,3,4,5,6-hexafluoro-N-propan-2-ylaniline.
| Compound Name | N,2,3,4,5,6-hexafluoro-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 87427327 |
| Molecular Formula | C9H7F6N |
| Molecular Weight | 243.15 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | N,2,3,4,5,6-hexafluoro-N-propan-2-ylaniline |
| SMILES | CC(C)N(F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C9H7F6N/c1-3(2)16(15)9-7(13)5(11)4(10)6(12)8(9)14/h3H,1-2H3 |
| InChIKey | SVUOYVUGVYDFKF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.15 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|