C21H27N2O5P — CID 87427826
N-[[(1S,3S,4S,7S)-1-[(2S)-but-3-en-2-yl]-7-[2-isocyanoethoxy(methyl)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide (PubChem CID 87427826) has the molecular formula C21H27N2O5P and a molecular weight of 418.43 g/mol. Its IUPAC name is N-[[(1S,3S,4S,7S)-1-[(2S)-but-3-en-2-yl]-7-[2-isocyanoethoxy(methyl)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide.
| Compound Name | N-[[(1S,3S,4S,7S)-1-[(2S)-but-3-en-2-yl]-7-[2-isocyanoethoxy(methyl)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide |
|---|---|
| PubChem CID | 87427826 |
| Molecular Formula | C21H27N2O5P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-[[(1S,3S,4S,7S)-1-[(2S)-but-3-en-2-yl]-7-[2-isocyanoethoxy(methyl)phosphanyl]oxy-2,5-dioxabicyclo[2.2.1]heptan-3-yl]methyl]benzamide |
| SMILES | [C-]#[N+]CCOP(C)O[C@H]1[C@H]2OC[C@]1([C@@H](C)C=C)O[C@H]2CNC(=O)c1ccccc1 |
| InChI | InChI=1S/C21H27N2O5P/c1-5-15(2)21-14-25-18(19(21)28-29(4)26-12-11-22-3)17(27-21)13-23-20(24)16-9-7-6-8-10-16/h5-10,15,17-19H,1,11-14H2,2,4H3,(H,23,24)/t15-,17-,18-,19-,21+,29?/m0/s1 |
| InChIKey | HDAWOKRYBIUFLD-QXPUDDDSSA-N |
| XLogP | 3.04 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|