About 1,1,4-trifluorohexa-1,5-diene
1,1,4-trifluorohexa-1,5-diene (PubChem CID 87427925) has the molecular formula C6H7F3
and a molecular weight of 136.12 g/mol. Its IUPAC name is 1,1,4-trifluorohexa-1,5-diene.
Molecular Properties
| Compound Name | 1,1,4-trifluorohexa-1,5-diene |
| PubChem CID | 87427925 |
| Molecular Formula | C6H7F3 |
| Molecular Weight | 136.12 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | 1,1,4-trifluorohexa-1,5-diene |
| SMILES | C=CC(F)CC=C(F)F |
| InChI | InChI=1S/C6H7F3/c1-2-5(7)3-4-6(8)9/h2,4-5H,1,3H2 |
| InChIKey | PLXQZYBFFCEVQQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,1,4-trifluorohexa-1,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,4-trifluorohexa-1,5-diene?
The IUPAC name of 1,1,4-trifluorohexa-1,5-diene (CID 87427925) is 1,1,4-trifluorohexa-1,5-diene.
What is the SMILES notation for 1,1,4-trifluorohexa-1,5-diene?
The canonical SMILES for 1,1,4-trifluorohexa-1,5-diene is C=CC(F)CC=C(F)F.
What is the InChIKey of 1,1,4-trifluorohexa-1,5-diene?
The InChIKey is PLXQZYBFFCEVQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3/c1-2-5(7)3-4-6(8)9/h2,4-5H,1,3H2.
What are the key properties of 1,1,4-trifluorohexa-1,5-diene?
1,1,4-trifluorohexa-1,5-diene has a molecular weight of 136.12 g/mol, XLogP of 2.68, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,4-trifluorohexa-1,5-diene is sourced from PubChem (CID 87427925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).