About tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate
tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate (PubChem CID 87428034) has the molecular formula C34H32FNO3
and a molecular weight of 521.63 g/mol. Its IUPAC name is tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate.
Molecular Properties
| Compound Name | tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate |
| PubChem CID | 87428034 |
| Molecular Formula | C34H32FNO3 |
| Molecular Weight | 521.63 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate |
| SMILES | CC(C)(C)OC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](CC(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C34H32FNO3/c1-34(2,3)39-33(38)32(36-31(26-15-9-5-10-16-26)27-17-11-6-12-18-27)29(24-19-21-28(35)22-20-24)23-30(37)25-13-7-4-8-14-25/h4-22,29,32H,23H2,1-3H3/t29-,32+/m0/s1 |
| InChIKey | GMQWJDBUJCEWLH-BHDXBOSCSA-N |
| XLogP | 7.43 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate?
The IUPAC name of tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate (CID 87428034) is tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate.
What is the SMILES notation for tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate?
The canonical SMILES for tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate is CC(C)(C)OC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@@H](CC(=O)c1ccccc1)c1ccc(F)cc1.
What is the InChIKey of tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate?
The InChIKey is GMQWJDBUJCEWLH-BHDXBOSCSA-N. The full InChI is InChI=1S/C34H32FNO3/c1-34(2,3)39-33(38)32(36-31(26-15-9-5-10-16-26)27-17-11-6-12-18-27)29(24-19-21-28(35)22-20-24)23-30(37)25-13-7-4-8-14-25/h4-22,29,32H,23H2,1-3H3/t29-,32+/m0/s1.
What are the key properties of tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate?
tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate has a molecular weight of 521.63 g/mol, XLogP of 7.43, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R,3S)-2-(benzhydrylideneamino)-3-(4-fluorophenyl)-5-oxo-5-phenylpentanoate is sourced from PubChem (CID 87428034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).