C24H22N4O4S — CID 87428360
3-but-3-enoxy-5-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]-N-(5-methyl-1,3-thiazol-2-yl)benzamide (PubChem CID 87428360) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is 3-but-3-enoxy-5-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]-N-(5-methyl-1,3-thiazol-2-yl)benzamide.
| Compound Name | 3-but-3-enoxy-5-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 87428360 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 3-but-3-enoxy-5-[4-(5-methyl-1,3,4-oxadiazol-2-yl)phenoxy]-N-(5-methyl-1,3-thiazol-2-yl)benzamide |
| SMILES | C=CCCOc1cc(Oc2ccc(-c3nnc(C)o3)cc2)cc(C(=O)Nc2ncc(C)s2)c1 |
| InChI | InChI=1S/C24H22N4O4S/c1-4-5-10-30-20-11-18(22(29)26-24-25-14-15(2)33-24)12-21(13-20)32-19-8-6-17(7-9-19)23-28-27-16(3)31-23/h4,6-9,11-14H,1,5,10H2,2-3H3,(H,25,26,29) |
| InChIKey | LCPDQSFKFDDHKO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 99.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|