C28H15F7O2 — CID 87428478
1,4,6-trifluoro-9-(4-methoxyphenyl)-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)anthracene (PubChem CID 87428478) has the molecular formula C28H15F7O2 and a molecular weight of 516.41 g/mol. Its IUPAC name is 1,4,6-trifluoro-9-(4-methoxyphenyl)-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)anthracene.
| Compound Name | 1,4,6-trifluoro-9-(4-methoxyphenyl)-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)anthracene |
|---|---|
| PubChem CID | 87428478 |
| Molecular Formula | C28H15F7O2 |
| Molecular Weight | 516.41 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | 1,4,6-trifluoro-9-(4-methoxyphenyl)-10-(2,3,5,6-tetrafluoro-4-methoxyphenyl)anthracene |
| SMILES | COc1ccc(-c2c3ccc(F)cc3c(-c3c(F)c(F)c(OC)c(F)c3F)c3c(F)ccc(F)c23)cc1 |
| InChI | InChI=1S/C28H15F7O2/c1-36-14-6-3-12(4-7-14)19-15-8-5-13(29)11-16(15)20(22-18(31)10-9-17(30)21(19)22)23-24(32)26(34)28(37-2)27(35)25(23)33/h3-11H,1-2H3 |
| InChIKey | KDINVIAJIFCMIP-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.41 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|