C32H18ClFN6 — CID 87428589
(2Z,4Z)-2-(5-chloro-1H-indol-3-yl)-5-(5-fluoro-1H-indol-3-yl)-3,4-dipyridin-3-ylhexa-2,4-dienedinitrile (PubChem CID 87428589) has the molecular formula C32H18ClFN6 and a molecular weight of 540.99 g/mol. Its IUPAC name is (2Z,4Z)-2-(5-chloro-1H-indol-3-yl)-5-(5-fluoro-1H-indol-3-yl)-3,4-dipyridin-3-ylhexa-2,4-dienedinitrile.
| Compound Name | (2Z,4Z)-2-(5-chloro-1H-indol-3-yl)-5-(5-fluoro-1H-indol-3-yl)-3,4-dipyridin-3-ylhexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 87428589 |
| Molecular Formula | C32H18ClFN6 |
| Molecular Weight | 540.99 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | (2Z,4Z)-2-(5-chloro-1H-indol-3-yl)-5-(5-fluoro-1H-indol-3-yl)-3,4-dipyridin-3-ylhexa-2,4-dienedinitrile |
| SMILES | N#C/C(=C(C(=C(/C#N)c1c[nH]c2ccc(Cl)cc12)/c1cccnc1)\c1cccnc1)c1c[nH]c2ccc(F)cc12 |
| InChI | InChI=1S/C32H18ClFN6/c33-21-5-7-29-23(11-21)27(17-39-29)25(13-35)31(19-3-1-9-37-15-19)32(20-4-2-10-38-16-20)26(14-36)28-18-40-30-8-6-22(34)12-24(28)30/h1-12,15-18,39-40H/b31-25-,32-26- |
| InChIKey | GUCFIIYGHIWBAS-WVMMTVHUSA-N |
| XLogP | 7.80 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.99 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|