C34H22FN5O — CID 87428866
(2Z,4Z)-3-(4-fluorophenyl)-2-(1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-4-pyridin-2-ylhexa-2,4-dienedinitrile (PubChem CID 87428866) has the molecular formula C34H22FN5O and a molecular weight of 535.58 g/mol. Its IUPAC name is (2Z,4Z)-3-(4-fluorophenyl)-2-(1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-4-pyridin-2-ylhexa-2,4-dienedinitrile.
| Compound Name | (2Z,4Z)-3-(4-fluorophenyl)-2-(1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-4-pyridin-2-ylhexa-2,4-dienedinitrile |
|---|---|
| PubChem CID | 87428866 |
| Molecular Formula | C34H22FN5O |
| Molecular Weight | 535.58 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (2Z,4Z)-3-(4-fluorophenyl)-2-(1H-indol-3-yl)-5-(5-methoxy-1H-indol-3-yl)-4-pyridin-2-ylhexa-2,4-dienedinitrile |
| SMILES | COc1ccc2[nH]cc(/C(C#N)=C(C(=C(/C#N)c3c[nH]c4ccccc34)\c3ccc(F)cc3)/c3ccccn3)c2c1 |
| InChI | InChI=1S/C34H22FN5O/c1-41-23-13-14-31-25(16-23)29(20-40-31)27(18-37)34(32-8-4-5-15-38-32)33(21-9-11-22(35)12-10-21)26(17-36)28-19-39-30-7-3-2-6-24(28)30/h2-16,19-20,39-40H,1H3/b33-26+,34-27- |
| InChIKey | WKAGKPOKWBGFHT-ALNDIFHZSA-N |
| XLogP | 7.76 |
| TPSA | 101.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.58 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|