C18H22FS+ — CID 87429191
fluoromethyl-(4-methylphenyl)-(2,3,4,5-tetramethylphenyl)sulfanium (PubChem CID 87429191) has the molecular formula C18H22FS+ and a molecular weight of 289.44 g/mol. Its IUPAC name is fluoromethyl-(4-methylphenyl)-(2,3,4,5-tetramethylphenyl)sulfanium.
| Compound Name | fluoromethyl-(4-methylphenyl)-(2,3,4,5-tetramethylphenyl)sulfanium |
|---|---|
| PubChem CID | 87429191 |
| Molecular Formula | C18H22FS+ |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | fluoromethyl-(4-methylphenyl)-(2,3,4,5-tetramethylphenyl)sulfanium |
| SMILES | Cc1ccc([S+](CF)c2cc(C)c(C)c(C)c2C)cc1 |
| InChI | InChI=1S/C18H22FS/c1-12-6-8-17(9-7-12)20(11-19)18-10-13(2)14(3)15(4)16(18)5/h6-10H,11H2,1-5H3/q+1 |
| InChIKey | CDFBVPLTTONFPN-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|