C21H36FO3P — CID 87429198
[[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]-methylphosphoryl] hypofluorite (PubChem CID 87429198) has the molecular formula C21H36FO3P and a molecular weight of 386.49 g/mol. Its IUPAC name is [[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]-methylphosphoryl] hypofluorite.
| Compound Name | [[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]-methylphosphoryl] hypofluorite |
|---|---|
| PubChem CID | 87429198 |
| Molecular Formula | C21H36FO3P |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | [[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoxy]-methylphosphoryl] hypofluorite |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCOP(C)(=O)OF |
| InChI | InChI=1S/C21H36FO3P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-26(2,23)25-22/h7-8,10-11,13-14,16-17H,3-6,9,12,15,18-21H2,1-2H3/b8-7-,11-10-,14-13-,17-16- |
| InChIKey | FTYQAMPNLUIJCE-ZKWNWVNESA-N |
| XLogP | 7.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|