About 1-hydroxypropan-2-one;dihydrate
1-hydroxypropan-2-one;dihydrate (PubChem CID 87429435) has the molecular formula C3H10O4
and a molecular weight of 110.11 g/mol. Its IUPAC name is 1-hydroxypropan-2-one;dihydrate.
Molecular Properties
| Compound Name | 1-hydroxypropan-2-one;dihydrate |
| PubChem CID | 87429435 |
| Molecular Formula | C3H10O4 |
| Molecular Weight | 110.11 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | 1-hydroxypropan-2-one;dihydrate |
| SMILES | CC(=O)CO.O.O |
| InChI | InChI=1S/C3H6O2.2H2O/c1-3(5)2-4;;/h4H,2H2,1H3;2*1H2 |
| InChIKey | HPGFUGUVPJRVEN-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 100.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.11 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hydroxypropan-2-one;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypropan-2-one;dihydrate?
The IUPAC name of 1-hydroxypropan-2-one;dihydrate (CID 87429435) is 1-hydroxypropan-2-one;dihydrate.
What is the SMILES notation for 1-hydroxypropan-2-one;dihydrate?
The canonical SMILES for 1-hydroxypropan-2-one;dihydrate is CC(=O)CO.O.O.
What is the InChIKey of 1-hydroxypropan-2-one;dihydrate?
The InChIKey is HPGFUGUVPJRVEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.2H2O/c1-3(5)2-4;;/h4H,2H2,1H3;2*1H2.
What are the key properties of 1-hydroxypropan-2-one;dihydrate?
1-hydroxypropan-2-one;dihydrate has a molecular weight of 110.11 g/mol, XLogP of -2.08, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypropan-2-one;dihydrate is sourced from PubChem (CID 87429435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).