C11H10BrF6N3O3S — CID 87429441
1-[(4-bromophenyl)sulfonylamino]-1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)urea (PubChem CID 87429441) has the molecular formula C11H10BrF6N3O3S and a molecular weight of 458.18 g/mol. Its IUPAC name is 1-[(4-bromophenyl)sulfonylamino]-1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)urea.
| Compound Name | 1-[(4-bromophenyl)sulfonylamino]-1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)urea |
|---|---|
| PubChem CID | 87429441 |
| Molecular Formula | C11H10BrF6N3O3S |
| Molecular Weight | 458.18 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | 1-[(4-bromophenyl)sulfonylamino]-1-(1,1,2,3,3,3-hexafluoro-2-methylpropyl)urea |
| SMILES | CC(F)(C(F)(F)F)C(F)(F)N(NS(=O)(=O)c1ccc(Br)cc1)C(N)=O |
| InChI | InChI=1S/C11H10BrF6N3O3S/c1-9(13,10(14,15)16)11(17,18)21(8(19)22)20-25(23,24)7-4-2-6(12)3-5-7/h2-5,20H,1H3,(H2,19,22) |
| InChIKey | YTAJWHUBHXOKRZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.18 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|