About 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine
5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine (PubChem CID 87429713) has the molecular formula C19H37N3Si2
and a molecular weight of 363.70 g/mol. Its IUPAC name is 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine.
Molecular Properties
| Compound Name | 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine |
| PubChem CID | 87429713 |
| Molecular Formula | C19H37N3Si2 |
| Molecular Weight | 363.70 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine |
| SMILES | [H]/N=C(/C(/C(=N/[H])C(CC)[Si](C)(C)C)n1cccc1)C(CC)[Si](C)(C)C |
| InChI | InChI=1S/C19H37N3Si2/c1-9-15(23(3,4)5)17(20)19(22-13-11-12-14-22)18(21)16(10-2)24(6,7)8/h11-16,19-21H,9-10H2,1-8H3/b20-17+,21-18+ |
| InChIKey | FWUSMXPJFFCYMT-PHEFWILJSA-N |
| XLogP | 6.31 |
| TPSA | 52.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 363.70 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine?
The IUPAC name of 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine (CID 87429713) is 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine.
What is the SMILES notation for 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine?
The canonical SMILES for 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine is [H]/N=C(/C(/C(=N/[H])C(CC)[Si](C)(C)C)n1cccc1)C(CC)[Si](C)(C)C.
What is the InChIKey of 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine?
The InChIKey is FWUSMXPJFFCYMT-PHEFWILJSA-N. The full InChI is InChI=1S/C19H37N3Si2/c1-9-15(23(3,4)5)17(20)19(22-13-11-12-14-22)18(21)16(10-2)24(6,7)8/h11-16,19-21H,9-10H2,1-8H3/b20-17+,21-18+.
What are the key properties of 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine?
5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine has a molecular weight of 363.70 g/mol, XLogP of 6.31, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrol-1-yl-3,7-bis(trimethylsilyl)nonane-4,6-diimine is sourced from PubChem (CID 87429713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).