About 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline
4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline (PubChem CID 874299) has the molecular formula C19H16N2S2
and a molecular weight of 336.49 g/mol. Its IUPAC name is 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline.
Molecular Properties
| Compound Name | 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline |
| PubChem CID | 874299 |
| Molecular Formula | C19H16N2S2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline |
| SMILES | Cc1ccc2sc(-c3ccc(NCc4cccs4)cc3)nc2c1 |
| InChI | InChI=1S/C19H16N2S2/c1-13-4-9-18-17(11-13)21-19(23-18)14-5-7-15(8-6-14)20-12-16-3-2-10-22-16/h2-11,20H,12H2,1H3 |
| InChIKey | GROPFIRWTVDBNI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline?
The IUPAC name of 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline (CID 874299) is 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline.
What is the SMILES notation for 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline?
The canonical SMILES for 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline is Cc1ccc2sc(-c3ccc(NCc4cccs4)cc3)nc2c1.
What is the InChIKey of 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline?
The InChIKey is GROPFIRWTVDBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2S2/c1-13-4-9-18-17(11-13)21-19(23-18)14-5-7-15(8-6-14)20-12-16-3-2-10-22-16/h2-11,20H,12H2,1H3.
What are the key properties of 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline?
4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline has a molecular weight of 336.49 g/mol, XLogP of 5.95, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-methyl-1,3-benzothiazol-2-yl)-N-(thiophen-2-ylmethyl)aniline is sourced from PubChem (CID 874299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).